![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Computer-aided modelling of bio-refinery units.pdf | 2018-03-19 17:41 | 111K | |
| DynamicSimulator.pdf | 2018-03-19 17:41 | 115K | |
| Fixed-bed mixing reactor experiment.pdf | 2018-03-19 17:40 | 46K | |
| HAZOP preventing control.pdf | 2018-03-19 17:40 | 45K | |
| Molecular Modelling.pdf | 2018-03-19 17:40 | 44K | |
| ThermoProp.pdf | 2018-03-19 17:38 | 46K | |
| computer-aided modelling distillation.pdf | 2018-03-19 17:41 | 50K | |
| spectral analysis of Raman spectra.pdf | 2018-03-19 17:39 | 44K | |
| supervisory control.pdf | 2018-03-19 17:39 | 76K | |